C17H16F2N2O2S2 — CID 78773608
N-[4-(difluoromethylsulfanyl)phenyl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 78773608) has the molecular formula C17H16F2N2O2S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 78773608 |
| Molecular Formula | C17H16F2N2O2S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(SC(F)F)cc1)C1CCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C17H16F2N2O2S2/c18-17(19)25-12-7-5-11(6-8-12)20-15(22)13-3-1-9-21(13)16(23)14-4-2-10-24-14/h2,4-8,10,13,17H,1,3,9H2,(H,20,22) |
| InChIKey | NEGAPHSMEAIKAV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |