C18H18F2N4O2S3 — CID 2083237
1-[4-(difluoromethylsulfanyl)phenyl]-3-[[(2R)-1-(thiophene-2-carbonyl)pyrrolidine-2-carbonyl]amino]thiourea (PubChem CID 2083237) has the molecular formula C18H18F2N4O2S3 and a molecular weight of 456.57 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-[[(2R)-1-(thiophene-2-carbonyl)pyrrolidine-2-carbonyl]amino]thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[[(2R)-1-(thiophene-2-carbonyl)pyrrolidine-2-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 2083237 |
| Molecular Formula | C18H18F2N4O2S3 |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[[(2R)-1-(thiophene-2-carbonyl)pyrrolidine-2-carbonyl]amino]thiourea |
| SMILES | O=C(NNC(=S)Nc1ccc(SC(F)F)cc1)[C@H]1CCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C18H18F2N4O2S3/c19-17(20)29-12-7-5-11(6-8-12)21-18(27)23-22-15(25)13-3-1-9-24(13)16(26)14-4-2-10-28-14/h2,4-8,10,13,17H,1,3,9H2,(H,22,25)(H2,21,23,27)/t13-/m1/s1 |
| InChIKey | OMWFBEQLQASRQS-CYBMUJFWSA-N |
| XLogP | 3.69 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|