C19H22N4O3S — CID 86922399
N-[4-(methylcarbamoylamino)phenyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide (PubChem CID 86922399) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is N-[4-(methylcarbamoylamino)phenyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide.
| Compound Name | N-[4-(methylcarbamoylamino)phenyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 86922399 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[4-(methylcarbamoylamino)phenyl]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
| SMILES | CNC(=O)Nc1ccc(NC(=O)C2CCCCN2C(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H22N4O3S/c1-20-19(26)22-14-9-7-13(8-10-14)21-17(24)15-5-2-3-11-23(15)18(25)16-6-4-12-27-16/h4,6-10,12,15H,2-3,5,11H2,1H3,(H,21,24)(H2,20,22,26) |
| InChIKey | NNFXHYSMSMRZQE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |