C22H26FN3O5S2 — CID 43019338
1-(4-fluorophenyl)sulfonyl-N-(3-piperidin-1-ylsulfonylphenyl)pyrrolidine-2-carboxamide (PubChem CID 43019338) has the molecular formula C22H26FN3O5S2 and a molecular weight of 495.60 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-(3-piperidin-1-ylsulfonylphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-(3-piperidin-1-ylsulfonylphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 43019338 |
| Molecular Formula | C22H26FN3O5S2 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-(3-piperidin-1-ylsulfonylphenyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCCCC2)c1)C1CCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H26FN3O5S2/c23-17-9-11-19(12-10-17)33(30,31)26-15-5-8-21(26)22(27)24-18-6-4-7-20(16-18)32(28,29)25-13-2-1-3-14-25/h4,6-7,9-12,16,21H,1-3,5,8,13-15H2,(H,24,27) |
| InChIKey | XSGPQFMJSNCYPN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |