C19H21N3O3 — CID 71889492
3,3-dicyclopropyl-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]prop-2-enamide (PubChem CID 71889492) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 3,3-dicyclopropyl-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]prop-2-enamide.
| Compound Name | 3,3-dicyclopropyl-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 71889492 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 3,3-dicyclopropyl-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]prop-2-enamide |
| SMILES | O=C(C=C(C1CC1)C1CC1)Nc1cccc(CN2C(=O)CNC2=O)c1 |
| InChI | InChI=1S/C19H21N3O3/c23-17(9-16(13-4-5-13)14-6-7-14)21-15-3-1-2-12(8-15)11-22-18(24)10-20-19(22)25/h1-3,8-9,13-14H,4-7,10-11H2,(H,20,25)(H,21,23) |
| InChIKey | GBEWRPQSGZNDPF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|