C16H23ClN4O3 — CID 119722221
2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-2-methylpentanamide;hydrochloride (PubChem CID 119722221) has the molecular formula C16H23ClN4O3 and a molecular weight of 354.84 g/mol. Its IUPAC name is 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-2-methylpentanamide;hydrochloride.
| Compound Name | 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-2-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119722221 |
| Molecular Formula | C16H23ClN4O3 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-amino-N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-2-methylpentanamide;hydrochloride |
| SMILES | CCCC(C)(N)C(=O)Nc1cccc(CN2C(=O)CNC2=O)c1.Cl |
| InChI | InChI=1S/C16H22N4O3.ClH/c1-3-7-16(2,17)14(22)19-12-6-4-5-11(8-12)10-20-13(21)9-18-15(20)23;/h4-6,8H,3,7,9-10,17H2,1-2H3,(H,18,23)(H,19,22);1H |
| InChIKey | ABUVUQDJJYEDBB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|