C20H20N4O4 — CID 48806971
1-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-3-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea (PubChem CID 48806971) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 1-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-3-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea.
| Compound Name | 1-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-3-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea |
|---|---|
| PubChem CID | 48806971 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 1-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-3-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea |
| SMILES | O=C(Nc1cccc(CN2C(=O)CNC2=O)c1)N[C@@H]1c2ccccc2C[C@@H]1O |
| InChI | InChI=1S/C20H20N4O4/c25-16-9-13-5-1-2-7-15(13)18(16)23-19(27)22-14-6-3-4-12(8-14)11-24-17(26)10-21-20(24)28/h1-8,16,18,25H,9-11H2,(H,21,28)(H2,22,23,27)/t16-,18+/m0/s1 |
| InChIKey | NXOMIMXEUCNHTE-FUHWJXTLSA-N |
| XLogP | 1.52 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|