C19H20N2O3 — CID 136532845
1-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-3-(3-propanoylphenyl)urea (PubChem CID 136532845) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-3-(3-propanoylphenyl)urea.
| Compound Name | 1-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-3-(3-propanoylphenyl)urea |
|---|---|
| PubChem CID | 136532845 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-3-(3-propanoylphenyl)urea |
| SMILES | CCC(=O)c1cccc(NC(=O)NC2c3ccccc3CC2O)c1 |
| InChI | InChI=1S/C19H20N2O3/c1-2-16(22)13-7-5-8-14(10-13)20-19(24)21-18-15-9-4-3-6-12(15)11-17(18)23/h3-10,17-18,23H,2,11H2,1H3,(H2,20,21,24) |
| InChIKey | YBHOUAIXSXGIND-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |