C17H15N3O2 — CID 60568438
1-(4-cyanophenyl)-3-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea (PubChem CID 60568438) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea |
|---|---|
| PubChem CID | 60568438 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea |
| SMILES | N#Cc1ccc(NC(=O)N[C@@H]2c3ccccc3C[C@@H]2O)cc1 |
| InChI | InChI=1S/C17H15N3O2/c18-10-11-5-7-13(8-6-11)19-17(22)20-16-14-4-2-1-3-12(14)9-15(16)21/h1-8,15-16,21H,9H2,(H2,19,20,22)/t15-,16+/m0/s1 |
| InChIKey | DDJNNZCOGZEXJI-JKSUJKDBSA-N |
| XLogP | 2.34 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |