C13H16N2O2 — CID 47374066
1-cyclopropyl-3-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea (PubChem CID 47374066) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea.
| Compound Name | 1-cyclopropyl-3-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea |
|---|---|
| PubChem CID | 47374066 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 1-cyclopropyl-3-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]urea |
| SMILES | O=C(NC1CC1)N[C@@H]1c2ccccc2C[C@@H]1O |
| InChI | InChI=1S/C13H16N2O2/c16-11-7-8-3-1-2-4-10(8)12(11)15-13(17)14-9-5-6-9/h1-4,9,11-12,16H,5-7H2,(H2,14,15,17)/t11-,12+/m0/s1 |
| InChIKey | KXUUWVPWVDXWPC-NWDGAFQWSA-N |
| XLogP | 1.11 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |