C22H26N2O2 — CID 86882639
1-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-(4-phenylcyclohexyl)urea (PubChem CID 86882639) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-(4-phenylcyclohexyl)urea.
| Compound Name | 1-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-(4-phenylcyclohexyl)urea |
|---|---|
| PubChem CID | 86882639 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-(4-phenylcyclohexyl)urea |
| SMILES | O=C(NC1CCC(c2ccccc2)CC1)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C22H26N2O2/c25-20-14-17-8-4-5-9-19(17)21(20)24-22(26)23-18-12-10-16(11-13-18)15-6-2-1-3-7-15/h1-9,16,18,20-21,25H,10-14H2,(H2,23,24,26)/t16?,18?,20-,21+/m1/s1 |
| InChIKey | WGZMSKGMMXDWAL-KPZFLHEBSA-N |
| XLogP | 3.67 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |