C20H22N2O3 — CID 110913063
1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-(2,3,4,5-tetrahydro-1-benzoxepin-5-yl)urea (PubChem CID 110913063) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-(2,3,4,5-tetrahydro-1-benzoxepin-5-yl)urea.
| Compound Name | 1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-(2,3,4,5-tetrahydro-1-benzoxepin-5-yl)urea |
|---|---|
| PubChem CID | 110913063 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-(2,3,4,5-tetrahydro-1-benzoxepin-5-yl)urea |
| SMILES | O=C(NC1CCCOc2ccccc21)N[C@@H]1c2ccccc2C[C@@H]1O |
| InChI | InChI=1S/C20H22N2O3/c23-17-12-13-6-1-2-7-14(13)19(17)22-20(24)21-16-9-5-11-25-18-10-4-3-8-15(16)18/h1-4,6-8,10,16-17,19,23H,5,9,11-12H2,(H2,21,22,24)/t16?,17-,19+/m0/s1 |
| InChIKey | SJCKUJNOHGWAID-WFTITGEASA-N |
| XLogP | 2.86 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |