C15H19NO3 — CID 62758276
N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)oxane-3-carboxamide (PubChem CID 62758276) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)oxane-3-carboxamide.
| Compound Name | N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)oxane-3-carboxamide |
|---|---|
| PubChem CID | 62758276 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)oxane-3-carboxamide |
| SMILES | O=C(NC1c2ccccc2CC1O)C1CCCOC1 |
| InChI | InChI=1S/C15H19NO3/c17-13-8-10-4-1-2-6-12(10)14(13)16-15(18)11-5-3-7-19-9-11/h1-2,4,6,11,13-14,17H,3,5,7-9H2,(H,16,18) |
| InChIKey | YEZOIHUNHPGXNJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |