C15H19NO3 — CID 103816843
N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]oxane-4-carboxamide (PubChem CID 103816843) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]oxane-4-carboxamide.
| Compound Name | N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 103816843 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]oxane-4-carboxamide |
| SMILES | O=C(N[C@H]1c2ccccc2C[C@H]1O)C1CCOCC1 |
| InChI | InChI=1S/C15H19NO3/c17-13-9-11-3-1-2-4-12(11)14(13)16-15(18)10-5-7-19-8-6-10/h1-4,10,13-14,17H,5-9H2,(H,16,18)/t13-,14+/m1/s1 |
| InChIKey | FYNFSHJXQPQDHU-KGLIPLIRSA-N |
| XLogP | 1.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |