C12H15NO — CID 77423862
1-(cyclopropylamino)-2,3-dihydro-1H-inden-2-ol (PubChem CID 77423862) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(cyclopropylamino)-2,3-dihydro-1H-inden-2-ol.
| Compound Name | 1-(cyclopropylamino)-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 77423862 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1-(cyclopropylamino)-2,3-dihydro-1H-inden-2-ol |
| SMILES | OC1Cc2ccccc2C1NC1CC1 |
| InChI | InChI=1S/C12H15NO/c14-11-7-8-3-1-2-4-10(8)12(11)13-9-5-6-9/h1-4,9,11-14H,5-7H2 |
| InChIKey | JZZUPGYXEOLAPO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |