C9H11NOS — CID 146535071
(1R,2R)-1-(sulfanylamino)-2,3-dihydro-1H-inden-2-ol (PubChem CID 146535071) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is (1R,2R)-1-(sulfanylamino)-2,3-dihydro-1H-inden-2-ol.
| Compound Name | (1R,2R)-1-(sulfanylamino)-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 146535071 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | (1R,2R)-1-(sulfanylamino)-2,3-dihydro-1H-inden-2-ol |
| SMILES | O[C@@H]1Cc2ccccc2[C@H]1NS |
| InChI | InChI=1S/C9H11NOS/c11-8-5-6-3-1-2-4-7(6)9(8)10-12/h1-4,8-12H,5H2/t8-,9-/m1/s1 |
| InChIKey | FGHYYZBUHFUNAR-RKDXNWHRSA-N |
| XLogP | 1.08 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|