C15H16N2O — CID 71922626
1-(pyridin-4-ylmethylamino)-2,3-dihydro-1H-inden-2-ol (PubChem CID 71922626) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-(pyridin-4-ylmethylamino)-2,3-dihydro-1H-inden-2-ol.
| Compound Name | 1-(pyridin-4-ylmethylamino)-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 71922626 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-(pyridin-4-ylmethylamino)-2,3-dihydro-1H-inden-2-ol |
| SMILES | OC1Cc2ccccc2C1NCc1ccncc1 |
| InChI | InChI=1S/C15H16N2O/c18-14-9-12-3-1-2-4-13(12)15(14)17-10-11-5-7-16-8-6-11/h1-8,14-15,17-18H,9-10H2 |
| InChIKey | HUCCLJWMKGZRPS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |