C19H23NO2 — CID 110910816
(1R,2S)-1-[(4-propoxyphenyl)methylamino]-2,3-dihydro-1H-inden-2-ol (PubChem CID 110910816) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (1R,2S)-1-[(4-propoxyphenyl)methylamino]-2,3-dihydro-1H-inden-2-ol.
| Compound Name | (1R,2S)-1-[(4-propoxyphenyl)methylamino]-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 110910816 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (1R,2S)-1-[(4-propoxyphenyl)methylamino]-2,3-dihydro-1H-inden-2-ol |
| SMILES | CCCOc1ccc(CN[C@@H]2c3ccccc3C[C@@H]2O)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-2-11-22-16-9-7-14(8-10-16)13-20-19-17-6-4-3-5-15(17)12-18(19)21/h3-10,18-21H,2,11-13H2,1H3/t18-,19+/m0/s1 |
| InChIKey | LERAPQAGQNGQRL-RBUKOAKNSA-N |
| XLogP | 3.22 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |