C22H21NO — CID 47075671
(1R,2S)-1-[(3-phenylphenyl)methylamino]-2,3-dihydro-1H-inden-2-ol (PubChem CID 47075671) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is (1R,2S)-1-[(3-phenylphenyl)methylamino]-2,3-dihydro-1H-inden-2-ol.
| Compound Name | (1R,2S)-1-[(3-phenylphenyl)methylamino]-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 47075671 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (1R,2S)-1-[(3-phenylphenyl)methylamino]-2,3-dihydro-1H-inden-2-ol |
| SMILES | O[C@H]1Cc2ccccc2[C@H]1NCc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H21NO/c24-21-14-19-10-4-5-12-20(19)22(21)23-15-16-7-6-11-18(13-16)17-8-2-1-3-9-17/h1-13,21-24H,14-15H2/t21-,22+/m0/s1 |
| InChIKey | ADLUILVUJQYBDL-FCHUYYIVSA-N |
| XLogP | 4.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |