About (1R,2R)-N-benzyl-2-methyl-2,3-dihydro-1H-inden-1-amine
(1R,2R)-N-benzyl-2-methyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 101384659) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is (1R,2R)-N-benzyl-2-methyl-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | (1R,2R)-N-benzyl-2-methyl-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 101384659 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | (1R,2R)-N-benzyl-2-methyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | C[C@@H]1Cc2ccccc2[C@@H]1NCc1ccccc1 |
| InChI | InChI=1S/C17H19N/c1-13-11-15-9-5-6-10-16(15)17(13)18-12-14-7-3-2-4-8-14/h2-10,13,17-18H,11-12H2,1H3/t13-,17-/m1/s1 |
| InChIKey | UZQLKZQQUXXQIQ-CXAGYDPISA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R,2R)-N-benzyl-2-methyl-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-N-benzyl-2-methyl-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of (1R,2R)-N-benzyl-2-methyl-2,3-dihydro-1H-inden-1-amine (CID 101384659) is (1R,2R)-N-benzyl-2-methyl-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for (1R,2R)-N-benzyl-2-methyl-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for (1R,2R)-N-benzyl-2-methyl-2,3-dihydro-1H-inden-1-amine is C[C@@H]1Cc2ccccc2[C@@H]1NCc1ccccc1.
What is the InChIKey of (1R,2R)-N-benzyl-2-methyl-2,3-dihydro-1H-inden-1-amine?
The InChIKey is UZQLKZQQUXXQIQ-CXAGYDPISA-N. The full InChI is InChI=1S/C17H19N/c1-13-11-15-9-5-6-10-16(15)17(13)18-12-14-7-3-2-4-8-14/h2-10,13,17-18H,11-12H2,1H3/t13-,17-/m1/s1.
What are the key properties of (1R,2R)-N-benzyl-2-methyl-2,3-dihydro-1H-inden-1-amine?
(1R,2R)-N-benzyl-2-methyl-2,3-dihydro-1H-inden-1-amine has a molecular weight of 237.35 g/mol, XLogP of 3.71, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-N-benzyl-2-methyl-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 101384659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).