C24H26N2 — CID 101357683
(3R,4S)-N,1-dibenzyl-3-methyl-3,4-dihydro-2H-quinolin-4-amine (PubChem CID 101357683) has the molecular formula C24H26N2 and a molecular weight of 342.49 g/mol. Its IUPAC name is (3R,4S)-N,1-dibenzyl-3-methyl-3,4-dihydro-2H-quinolin-4-amine.
| Compound Name | (3R,4S)-N,1-dibenzyl-3-methyl-3,4-dihydro-2H-quinolin-4-amine |
|---|---|
| PubChem CID | 101357683 |
| Molecular Formula | C24H26N2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (3R,4S)-N,1-dibenzyl-3-methyl-3,4-dihydro-2H-quinolin-4-amine |
| SMILES | C[C@@H]1CN(Cc2ccccc2)c2ccccc2[C@H]1NCc1ccccc1 |
| InChI | InChI=1S/C24H26N2/c1-19-17-26(18-21-12-6-3-7-13-21)23-15-9-8-14-22(23)24(19)25-16-20-10-4-2-5-11-20/h2-15,19,24-25H,16-18H2,1H3/t19-,24+/m1/s1 |
| InChIKey | RRUKLJHTVBKQLZ-DVECYGJZSA-N |
| XLogP | 5.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |