C25H28N4O — CID 134143901
(3R,5S)-N,1-dibenzyl-3,5-dimethyl-3,5-dihydro-2H-pyrido[4,3-e][1,4]diazepine-4-carboxamide (PubChem CID 134143901) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is (3R,5S)-N,1-dibenzyl-3,5-dimethyl-3,5-dihydro-2H-pyrido[4,3-e][1,4]diazepine-4-carboxamide.
| Compound Name | (3R,5S)-N,1-dibenzyl-3,5-dimethyl-3,5-dihydro-2H-pyrido[4,3-e][1,4]diazepine-4-carboxamide |
|---|---|
| PubChem CID | 134143901 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (3R,5S)-N,1-dibenzyl-3,5-dimethyl-3,5-dihydro-2H-pyrido[4,3-e][1,4]diazepine-4-carboxamide |
| SMILES | C[C@@H]1CN(Cc2ccccc2)c2ccncc2[C@H](C)N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H28N4O/c1-19-17-28(18-22-11-7-4-8-12-22)24-13-14-26-16-23(24)20(2)29(19)25(30)27-15-21-9-5-3-6-10-21/h3-14,16,19-20H,15,17-18H2,1-2H3,(H,27,30)/t19-,20+/m1/s1 |
| InChIKey | FXQIXJJVPMVJQZ-UXHICEINSA-N |
| XLogP | 4.76 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |