C25H27ClN4O — CID 134143554
(3R,5S)-N,1-dibenzyl-8-chloro-3,5-dimethyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine-4-carboxamide (PubChem CID 134143554) has the molecular formula C25H27ClN4O and a molecular weight of 434.97 g/mol. Its IUPAC name is (3R,5S)-N,1-dibenzyl-8-chloro-3,5-dimethyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine-4-carboxamide.
| Compound Name | (3R,5S)-N,1-dibenzyl-8-chloro-3,5-dimethyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine-4-carboxamide |
|---|---|
| PubChem CID | 134143554 |
| Molecular Formula | C25H27ClN4O |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (3R,5S)-N,1-dibenzyl-8-chloro-3,5-dimethyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine-4-carboxamide |
| SMILES | C[C@@H]1CN(Cc2ccccc2)c2nc(Cl)ccc2[C@H](C)N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H27ClN4O/c1-18-16-29(17-21-11-7-4-8-12-21)24-22(13-14-23(26)28-24)19(2)30(18)25(31)27-15-20-9-5-3-6-10-20/h3-14,18-19H,15-17H2,1-2H3,(H,27,31)/t18-,19+/m1/s1 |
| InChIKey | JEEPAZPOYVQOTG-MOPGFXCFSA-N |
| XLogP | 5.42 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|