C16H16FN — CID 135054757
(3R)-1-benzyl-4-fluoro-3-methyl-2,3-dihydroindole (PubChem CID 135054757) has the molecular formula C16H16FN and a molecular weight of 241.31 g/mol. Its IUPAC name is (3R)-1-benzyl-4-fluoro-3-methyl-2,3-dihydroindole.
| Compound Name | (3R)-1-benzyl-4-fluoro-3-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 135054757 |
| Molecular Formula | C16H16FN |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (3R)-1-benzyl-4-fluoro-3-methyl-2,3-dihydroindole |
| SMILES | C[C@H]1CN(Cc2ccccc2)c2cccc(F)c21 |
| InChI | InChI=1S/C16H16FN/c1-12-10-18(11-13-6-3-2-4-7-13)15-9-5-8-14(17)16(12)15/h2-9,12H,10-11H2,1H3/t12-/m0/s1 |
| InChIKey | LTSLVHYUWIGLIE-LBPRGKRZSA-N |
| XLogP | 3.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |