C19H23N — CID 171430341
1-benzyl-3-propan-2-yl-3,4-dihydro-2H-quinoline (PubChem CID 171430341) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 1-benzyl-3-propan-2-yl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-benzyl-3-propan-2-yl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 171430341 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 1-benzyl-3-propan-2-yl-3,4-dihydro-2H-quinoline |
| SMILES | CC(C)C1Cc2ccccc2N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H23N/c1-15(2)18-12-17-10-6-7-11-19(17)20(14-18)13-16-8-4-3-5-9-16/h3-11,15,18H,12-14H2,1-2H3 |
| InChIKey | LHBJPGPSTQPRPB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |