C18H22N2 — CID 115107303
1-(1-benzyl-2,3-dihydroindol-2-yl)-N-methylethanamine (PubChem CID 115107303) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 1-(1-benzyl-2,3-dihydroindol-2-yl)-N-methylethanamine.
| Compound Name | 1-(1-benzyl-2,3-dihydroindol-2-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 115107303 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1-(1-benzyl-2,3-dihydroindol-2-yl)-N-methylethanamine |
| SMILES | CNC(C)C1Cc2ccccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C18H22N2/c1-14(19-2)18-12-16-10-6-7-11-17(16)20(18)13-15-8-4-3-5-9-15/h3-11,14,18-19H,12-13H2,1-2H3 |
| InChIKey | BDKFKUJTDINLMP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |