C16H15NO — CID 59912246
(2S)-1-benzyl-2,3-dihydroindole-2-carbaldehyde (PubChem CID 59912246) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is (2S)-1-benzyl-2,3-dihydroindole-2-carbaldehyde.
| Compound Name | (2S)-1-benzyl-2,3-dihydroindole-2-carbaldehyde |
|---|---|
| PubChem CID | 59912246 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (2S)-1-benzyl-2,3-dihydroindole-2-carbaldehyde |
| SMILES | O=C[C@@H]1Cc2ccccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C16H15NO/c18-12-15-10-14-8-4-5-9-16(14)17(15)11-13-6-2-1-3-7-13/h1-9,12,15H,10-11H2/t15-/m0/s1 |
| InChIKey | OZMUVGXPBLRPRG-HNNXBMFYSA-N |
| XLogP | 2.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|