C17H17NO — CID 71351349
(3S)-1-benzyl-3-methyl-3,4-dihydroquinolin-2-one (PubChem CID 71351349) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is (3S)-1-benzyl-3-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | (3S)-1-benzyl-3-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 71351349 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (3S)-1-benzyl-3-methyl-3,4-dihydroquinolin-2-one |
| SMILES | C[C@H]1Cc2ccccc2N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C17H17NO/c1-13-11-15-9-5-6-10-16(15)18(17(13)19)12-14-7-3-2-4-8-14/h2-10,13H,11-12H2,1H3/t13-/m0/s1 |
| InChIKey | UJLXYVAINYAPOO-ZDUSSCGKSA-N |
| XLogP | 3.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |