C20H23NO — CID 102400070
1-benzyl-3,3,4-trimethyl-4,5-dihydro-1-benzazepin-2-one (PubChem CID 102400070) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-benzyl-3,3,4-trimethyl-4,5-dihydro-1-benzazepin-2-one.
| Compound Name | 1-benzyl-3,3,4-trimethyl-4,5-dihydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 102400070 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 1-benzyl-3,3,4-trimethyl-4,5-dihydro-1-benzazepin-2-one |
| SMILES | CC1Cc2ccccc2N(Cc2ccccc2)C(=O)C1(C)C |
| InChI | InChI=1S/C20H23NO/c1-15-13-17-11-7-8-12-18(17)21(19(22)20(15,2)3)14-16-9-5-4-6-10-16/h4-12,15H,13-14H2,1-3H3 |
| InChIKey | QNSRSPKLAWUVAA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |