C25H24N2O2 — CID 101469872
(3S)-N,1-dibenzyl-3-methyl-2-oxo-4H-quinoline-3-carboxamide (PubChem CID 101469872) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is (3S)-N,1-dibenzyl-3-methyl-2-oxo-4H-quinoline-3-carboxamide.
| Compound Name | (3S)-N,1-dibenzyl-3-methyl-2-oxo-4H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 101469872 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (3S)-N,1-dibenzyl-3-methyl-2-oxo-4H-quinoline-3-carboxamide |
| SMILES | C[C@@]1(C(=O)NCc2ccccc2)Cc2ccccc2N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C25H24N2O2/c1-25(23(28)26-17-19-10-4-2-5-11-19)16-21-14-8-9-15-22(21)27(24(25)29)18-20-12-6-3-7-13-20/h2-15H,16-18H2,1H3,(H,26,28)/t25-/m0/s1 |
| InChIKey | ANWLVOWCKVPVGE-VWLOTQADSA-N |
| XLogP | 4.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|