C26H33N3O5 — CID 132547389
tert-butyl N-[(1S)-1-[(3S)-1-benzyl-3-nitro-2-oxo-4H-quinolin-3-yl]-3-methylbutyl]carbamate (PubChem CID 132547389) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[(3S)-1-benzyl-3-nitro-2-oxo-4H-quinolin-3-yl]-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[(3S)-1-benzyl-3-nitro-2-oxo-4H-quinolin-3-yl]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 132547389 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | tert-butyl N-[(1S)-1-[(3S)-1-benzyl-3-nitro-2-oxo-4H-quinolin-3-yl]-3-methylbutyl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)[C@@]1([N+](=O)[O-])Cc2ccccc2N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C26H33N3O5/c1-18(2)15-22(27-24(31)34-25(3,4)5)26(29(32)33)16-20-13-9-10-14-21(20)28(23(26)30)17-19-11-7-6-8-12-19/h6-14,18,22H,15-17H2,1-5H3,(H,27,31)/t22-,26-/m0/s1 |
| InChIKey | YLBPBHZLZCSUTI-NVQXNPDNSA-N |
| XLogP | 4.73 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|