C29H31N3O6 — CID 132547379
tert-butyl N-[(S)-[(3S)-1-benzyl-3-nitro-2-oxo-4H-quinolin-3-yl]-(4-methoxyphenyl)methyl]carbamate (PubChem CID 132547379) has the molecular formula C29H31N3O6 and a molecular weight of 517.58 g/mol. Its IUPAC name is tert-butyl N-[(S)-[(3S)-1-benzyl-3-nitro-2-oxo-4H-quinolin-3-yl]-(4-methoxyphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(S)-[(3S)-1-benzyl-3-nitro-2-oxo-4H-quinolin-3-yl]-(4-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 132547379 |
| Molecular Formula | C29H31N3O6 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | tert-butyl N-[(S)-[(3S)-1-benzyl-3-nitro-2-oxo-4H-quinolin-3-yl]-(4-methoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc([C@H](NC(=O)OC(C)(C)C)[C@@]2([N+](=O)[O-])Cc3ccccc3N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C29H31N3O6/c1-28(2,3)38-27(34)30-25(21-14-16-23(37-4)17-15-21)29(32(35)36)18-22-12-8-9-13-24(22)31(26(29)33)19-20-10-6-5-7-11-20/h5-17,25H,18-19H2,1-4H3,(H,30,34)/t25-,29-/m0/s1 |
| InChIKey | QIXLNLMPUTUUGI-SVEHJYQDSA-N |
| XLogP | 5.07 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|