C15H21BrN2O5 — CID 102203556
tert-butyl N-[(1R,2R)-2-bromo-1-(4-methoxyphenyl)-2-nitropropyl]carbamate (PubChem CID 102203556) has the molecular formula C15H21BrN2O5 and a molecular weight of 389.25 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-2-bromo-1-(4-methoxyphenyl)-2-nitropropyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-2-bromo-1-(4-methoxyphenyl)-2-nitropropyl]carbamate |
|---|---|
| PubChem CID | 102203556 |
| Molecular Formula | C15H21BrN2O5 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | tert-butyl N-[(1R,2R)-2-bromo-1-(4-methoxyphenyl)-2-nitropropyl]carbamate |
| SMILES | COc1ccc([C@@H](NC(=O)OC(C)(C)C)[C@@](C)(Br)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H21BrN2O5/c1-14(2,3)23-13(19)17-12(15(4,16)18(20)21)10-6-8-11(22-5)9-7-10/h6-9,12H,1-5H3,(H,17,19)/t12-,15+/m1/s1 |
| InChIKey | ZWQDTKDFMRUOIK-DOMZBBRYSA-N |
| XLogP | 3.65 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|