C19H28N2O6 — CID 140557328
tert-butyl (2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-nitro-3-phenylpropanoate (PubChem CID 140557328) has the molecular formula C19H28N2O6 and a molecular weight of 380.44 g/mol. Its IUPAC name is tert-butyl (2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-nitro-3-phenylpropanoate.
| Compound Name | tert-butyl (2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-nitro-3-phenylpropanoate |
|---|---|
| PubChem CID | 140557328 |
| Molecular Formula | C19H28N2O6 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | tert-butyl (2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-nitro-3-phenylpropanoate |
| SMILES | CC(C)(C)OC(=O)NC(c1ccccc1)[C@](C)(C(=O)OC(C)(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C19H28N2O6/c1-17(2,3)26-15(22)19(7,21(24)25)14(13-11-9-8-10-12-13)20-16(23)27-18(4,5)6/h8-12,14H,1-7H3,(H,20,23)/t14?,19-/m1/s1 |
| InChIKey | QUJSKHCZOQDUAJ-JANGERMGSA-N |
| XLogP | 3.63 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|