C17H26N2O7 — CID 102521028
tert-butyl (2R,3S)-3-(furan-2-yl)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-nitropropanoate (PubChem CID 102521028) has the molecular formula C17H26N2O7 and a molecular weight of 370.40 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-(furan-2-yl)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-nitropropanoate.
| Compound Name | tert-butyl (2R,3S)-3-(furan-2-yl)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-nitropropanoate |
|---|---|
| PubChem CID | 102521028 |
| Molecular Formula | C17H26N2O7 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | tert-butyl (2R,3S)-3-(furan-2-yl)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-nitropropanoate |
| SMILES | CC(C)(C)OC(=O)N[C@H](c1ccco1)[C@](C)(C(=O)OC(C)(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N2O7/c1-15(2,3)25-13(20)17(7,19(22)23)12(11-9-8-10-24-11)18-14(21)26-16(4,5)6/h8-10,12H,1-7H3,(H,18,21)/t12-,17-/m1/s1 |
| InChIKey | JANFDNLQPKIDIS-SJKOYZFVSA-N |
| XLogP | 3.22 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|