C15H20FNO7 — CID 154713410
dimethyl 2-fluoro-2-[(S)-furan-2-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]propanedioate (PubChem CID 154713410) has the molecular formula C15H20FNO7 and a molecular weight of 345.32 g/mol. Its IUPAC name is dimethyl 2-fluoro-2-[(S)-furan-2-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]propanedioate.
| Compound Name | dimethyl 2-fluoro-2-[(S)-furan-2-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]propanedioate |
|---|---|
| PubChem CID | 154713410 |
| Molecular Formula | C15H20FNO7 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | dimethyl 2-fluoro-2-[(S)-furan-2-yl-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]propanedioate |
| SMILES | COC(=O)C(F)(C(=O)OC)[C@@H](NC(=O)OC(C)(C)C)c1ccco1 |
| InChI | InChI=1S/C15H20FNO7/c1-14(2,3)24-13(20)17-10(9-7-6-8-23-9)15(16,11(18)21-4)12(19)22-5/h6-8,10H,1-5H3,(H,17,20)/t10-/m0/s1 |
| InChIKey | OUPAUDUDAHHBAK-JTQLQIEISA-N |
| XLogP | 1.90 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|