C20H23NO4 — CID 132574724
tert-butyl N-[(R)-furan-2-yl-[(2R)-2-methyl-3-oxo-1H-inden-2-yl]methyl]carbamate (PubChem CID 132574724) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is tert-butyl N-[(R)-furan-2-yl-[(2R)-2-methyl-3-oxo-1H-inden-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[(R)-furan-2-yl-[(2R)-2-methyl-3-oxo-1H-inden-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 132574724 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | tert-butyl N-[(R)-furan-2-yl-[(2R)-2-methyl-3-oxo-1H-inden-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](c1ccco1)[C@@]1(C)Cc2ccccc2C1=O |
| InChI | InChI=1S/C20H23NO4/c1-19(2,3)25-18(23)21-16(15-10-7-11-24-15)20(4)12-13-8-5-6-9-14(13)17(20)22/h5-11,16H,12H2,1-4H3,(H,21,23)/t16-,20+/m0/s1 |
| InChIKey | RCPFPNBWAJDNTI-OXJNMPFZSA-N |
| XLogP | 4.29 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |