C21H21F2NO3 — CID 132937271
tert-butyl N-[(S)-[(2S)-2-fluoro-3-oxo-1H-inden-2-yl]-(4-fluorophenyl)methyl]carbamate (PubChem CID 132937271) has the molecular formula C21H21F2NO3 and a molecular weight of 373.40 g/mol. Its IUPAC name is tert-butyl N-[(S)-[(2S)-2-fluoro-3-oxo-1H-inden-2-yl]-(4-fluorophenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(S)-[(2S)-2-fluoro-3-oxo-1H-inden-2-yl]-(4-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 132937271 |
| Molecular Formula | C21H21F2NO3 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | tert-butyl N-[(S)-[(2S)-2-fluoro-3-oxo-1H-inden-2-yl]-(4-fluorophenyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](c1ccc(F)cc1)[C@@]1(F)Cc2ccccc2C1=O |
| InChI | InChI=1S/C21H21F2NO3/c1-20(2,3)27-19(26)24-17(13-8-10-15(22)11-9-13)21(23)12-14-6-4-5-7-16(14)18(21)25/h4-11,17H,12H2,1-3H3,(H,24,26)/t17-,21-/m0/s1 |
| InChIKey | JHGFGGIHPVJBCQ-UWJYYQICSA-N |
| XLogP | 4.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |