C11H15NO4 — CID 130003969
tert-butyl N-[1-(furan-2-yl)-2-oxoethyl]carbamate (PubChem CID 130003969) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is tert-butyl N-[1-(furan-2-yl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[1-(furan-2-yl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 130003969 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | tert-butyl N-[1-(furan-2-yl)-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C=O)c1ccco1 |
| InChI | InChI=1S/C11H15NO4/c1-11(2,3)16-10(14)12-8(7-13)9-5-4-6-15-9/h4-8H,1-3H3,(H,12,14) |
| InChIKey | LKRKMSDLBFAJMK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|