C13H17NO4 — CID 84729025
tert-butyl N-[1-(2-hydroxyphenyl)-2-oxoethyl]carbamate (PubChem CID 84729025) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is tert-butyl N-[1-(2-hydroxyphenyl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[1-(2-hydroxyphenyl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 84729025 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | tert-butyl N-[1-(2-hydroxyphenyl)-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C=O)c1ccccc1O |
| InChI | InChI=1S/C13H17NO4/c1-13(2,3)18-12(17)14-10(8-15)9-6-4-5-7-11(9)16/h4-8,10,16H,1-3H3,(H,14,17) |
| InChIKey | XOXHZGCWTHBLSP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|