C19H26N2O4 — CID 102069202
tert-butyl N-[(1R,2S)-1-[benzyl(hydroxy)amino]-1-(furan-2-yl)propan-2-yl]carbamate (PubChem CID 102069202) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-1-[benzyl(hydroxy)amino]-1-(furan-2-yl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-1-[benzyl(hydroxy)amino]-1-(furan-2-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 102069202 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | tert-butyl N-[(1R,2S)-1-[benzyl(hydroxy)amino]-1-(furan-2-yl)propan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)[C@H](c1ccco1)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C19H26N2O4/c1-14(20-18(22)25-19(2,3)4)17(16-11-8-12-24-16)21(23)13-15-9-6-5-7-10-15/h5-12,14,17,23H,13H2,1-4H3,(H,20,22)/t14-,17+/m0/s1 |
| InChIKey | UYHMOQGRRUHURT-WMLDXEAASA-N |
| XLogP | 4.13 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|