C18H30N2O3 — CID 130869227
tert-butyl N-[(2R,3S)-2-[benzyl(hydroxy)amino]-4-methylpentan-3-yl]carbamate (PubChem CID 130869227) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-2-[benzyl(hydroxy)amino]-4-methylpentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-2-[benzyl(hydroxy)amino]-4-methylpentan-3-yl]carbamate |
|---|---|
| PubChem CID | 130869227 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | tert-butyl N-[(2R,3S)-2-[benzyl(hydroxy)amino]-4-methylpentan-3-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)[C@@H](C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C18H30N2O3/c1-13(2)16(19-17(21)23-18(4,5)6)14(3)20(22)12-15-10-8-7-9-11-15/h7-11,13-14,16,22H,12H2,1-6H3,(H,19,21)/t14-,16+/m1/s1 |
| InChIKey | ISUPMCAQGKFBEW-ZBFHGGJFSA-N |
| XLogP | 3.82 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|