C19H32N2O3Si — CID 174058064
tert-butyl N-[1-[benzyl(trimethylsilylmethyl)amino]-1-oxopropan-2-yl]carbamate (PubChem CID 174058064) has the molecular formula C19H32N2O3Si and a molecular weight of 364.56 g/mol. Its IUPAC name is tert-butyl N-[1-[benzyl(trimethylsilylmethyl)amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[benzyl(trimethylsilylmethyl)amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 174058064 |
| Molecular Formula | C19H32N2O3Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | tert-butyl N-[1-[benzyl(trimethylsilylmethyl)amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)N(Cc1ccccc1)C[Si](C)(C)C |
| InChI | InChI=1S/C19H32N2O3Si/c1-15(20-18(23)24-19(2,3)4)17(22)21(14-25(5,6)7)13-16-11-9-8-10-12-16/h8-12,15H,13-14H2,1-7H3,(H,20,23) |
| InChIKey | IJACWEJBWUMMGO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|