C20H22N2O4 — CID 54418360
tert-butyl N-[(2S)-4-cyano-4-(furan-2-yl)-3-oxo-1-phenylbutan-2-yl]carbamate (PubChem CID 54418360) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-cyano-4-(furan-2-yl)-3-oxo-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-cyano-4-(furan-2-yl)-3-oxo-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 54418360 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | tert-butyl N-[(2S)-4-cyano-4-(furan-2-yl)-3-oxo-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)C(=O)C(C#N)c1ccco1 |
| InChI | InChI=1S/C20H22N2O4/c1-20(2,3)26-19(24)22-16(12-14-8-5-4-6-9-14)18(23)15(13-21)17-10-7-11-25-17/h4-11,15-16H,12H2,1-3H3,(H,22,24)/t15?,16-/m0/s1 |
| InChIKey | VZBAHRKPFCADLG-LYKKTTPLSA-N |
| XLogP | 3.59 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |