C21H24N2O2 — CID 101158097
tert-butyl N-[(1R,2S)-2-cyano-1,2-diphenylpropyl]carbamate (PubChem CID 101158097) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-2-cyano-1,2-diphenylpropyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-2-cyano-1,2-diphenylpropyl]carbamate |
|---|---|
| PubChem CID | 101158097 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | tert-butyl N-[(1R,2S)-2-cyano-1,2-diphenylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](c1ccccc1)[C@@](C)(C#N)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O2/c1-20(2,3)25-19(24)23-18(16-11-7-5-8-12-16)21(4,15-22)17-13-9-6-10-14-17/h5-14,18H,1-4H3,(H,23,24)/t18-,21+/m1/s1 |
| InChIKey | SVVZJFLVIFGMGP-NQIIRXRSSA-N |
| XLogP | 4.73 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |