C18H26ClNO5 — CID 165440520
chloromethyl 3-(4-methoxyphenyl)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 165440520) has the molecular formula C18H26ClNO5 and a molecular weight of 371.86 g/mol. Its IUPAC name is chloromethyl 3-(4-methoxyphenyl)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | chloromethyl 3-(4-methoxyphenyl)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 165440520 |
| Molecular Formula | C18H26ClNO5 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | chloromethyl 3-(4-methoxyphenyl)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COc1ccc(C(NC(=O)OC(C)(C)C)C(C)(C)C(=O)OCCl)cc1 |
| InChI | InChI=1S/C18H26ClNO5/c1-17(2,3)25-16(22)20-14(18(4,5)15(21)24-11-19)12-7-9-13(23-6)10-8-12/h7-10,14H,11H2,1-6H3,(H,20,22) |
| InChIKey | YWPDMSNURLRVQY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|