C17H27NO3S — CID 10544071
tert-butyl N-[(2S)-1-(4-methoxyphenyl)sulfanyl-3-methylbutan-2-yl]carbamate (PubChem CID 10544071) has the molecular formula C17H27NO3S and a molecular weight of 325.47 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(4-methoxyphenyl)sulfanyl-3-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(4-methoxyphenyl)sulfanyl-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10544071 |
| Molecular Formula | C17H27NO3S |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | tert-butyl N-[(2S)-1-(4-methoxyphenyl)sulfanyl-3-methylbutan-2-yl]carbamate |
| SMILES | COc1ccc(SC[C@@H](NC(=O)OC(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C17H27NO3S/c1-12(2)15(18-16(19)21-17(3,4)5)11-22-14-9-7-13(20-6)8-10-14/h7-10,12,15H,11H2,1-6H3,(H,18,19)/t15-/m1/s1 |
| InChIKey | OJYUQTLPDDWPLW-OAHLLOKOSA-N |
| XLogP | 4.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |