C18H23NO5 — CID 101352736
tert-butyl N-[(R)-(5-methoxyfuran-2-yl)-(4-methoxyphenyl)methyl]carbamate (PubChem CID 101352736) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is tert-butyl N-[(R)-(5-methoxyfuran-2-yl)-(4-methoxyphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(R)-(5-methoxyfuran-2-yl)-(4-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 101352736 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | tert-butyl N-[(R)-(5-methoxyfuran-2-yl)-(4-methoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc([C@@H](NC(=O)OC(C)(C)C)c2ccc(OC)o2)cc1 |
| InChI | InChI=1S/C18H23NO5/c1-18(2,3)24-17(20)19-16(14-10-11-15(22-5)23-14)12-6-8-13(21-4)9-7-12/h6-11,16H,1-5H3,(H,19,20)/t16-/m1/s1 |
| InChIKey | WTTHQPYVDCPKFM-MRXNPFEDSA-N |
| XLogP | 3.91 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |