C13H21NO4 — CID 134857276
tert-butyl N-[1-(5-methoxyfuran-2-yl)propyl]carbamate (PubChem CID 134857276) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is tert-butyl N-[1-(5-methoxyfuran-2-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[1-(5-methoxyfuran-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 134857276 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | tert-butyl N-[1-(5-methoxyfuran-2-yl)propyl]carbamate |
| SMILES | CCC(NC(=O)OC(C)(C)C)c1ccc(OC)o1 |
| InChI | InChI=1S/C13H21NO4/c1-6-9(10-7-8-11(16-5)17-10)14-12(15)18-13(2,3)4/h7-9H,6H2,1-5H3,(H,14,15) |
| InChIKey | HOKZUNNJJREFPR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |