C12H19ClN2O3 — CID 83694071
tert-butyl N-[3-amino-1-(5-chlorofuran-2-yl)propyl]carbamate (PubChem CID 83694071) has the molecular formula C12H19ClN2O3 and a molecular weight of 274.75 g/mol. Its IUPAC name is tert-butyl N-[3-amino-1-(5-chlorofuran-2-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-amino-1-(5-chlorofuran-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 83694071 |
| Molecular Formula | C12H19ClN2O3 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | tert-butyl N-[3-amino-1-(5-chlorofuran-2-yl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCN)c1ccc(Cl)o1 |
| InChI | InChI=1S/C12H19ClN2O3/c1-12(2,3)18-11(16)15-8(6-7-14)9-4-5-10(13)17-9/h4-5,8H,6-7,14H2,1-3H3,(H,15,16) |
| InChIKey | GOYYXJNSPUDWFH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |